| Identification | |
| Name: | Amylodextrin |
| Synonyms: | Amylogen;Dextrin, amylo;Kordek;OSK 03a;Soluble starch;Stabilose AO;Stabilose K;Zulkovskystarch;a-Amylodextrin;Potato Starch; |
| CAS: | 9005-84-9 |
| EINECS: | 232-686-4 |
| Molecular Formula: | Unspecified |
| Molecular Weight: | 342.29648 |
| InChI: | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 357.8°C |
| Boiling Point: | 667.9°Cat760mmHg |
| Density: | 1.5 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | slight in cold water, more substantial in hot water |
| Solubility: | slight in cold water, more substantial in hot water |
| Appearance: | white powder |
| Specification: |
Amylodextrin , its cas register number is 9005-84-9. It also can be called Starch soluble ; and Starch, soluble . |
| HS Code: | 35051090 |
| Flash Point: | 357.8°C |
| Storage Temperature: | Store in a cool, dry place. |
| Usage: | For determination of diastatic power of malt, etc.. |
| Safety Data | |
 |
|
