| Identification | |
| Name: | Benzeneacetic acid, a,2-dichloro-, methyl ester |
| Synonyms: | Methylchloro(2-chlorophenyl)acetate; Methyl a,2-dichlorobenzeneacetate |
| CAS: | 90055-47-3 |
| Molecular Formula: | C9H8 Cl2 O2 |
| Molecular Weight: | 219.06 |
| InChI: | InChI=1/C9H8Cl2O2/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.699°C |
| Boiling Point: | 270.883°C at 760 mmHg |
| Density: | 1.317g/cm3 |
| Refractive index: | 1.537 |
| Specification: |
2,2'-Diclorophenylacetic acid methyl ester , its cas register number is 90055-47-3. It also can be called Benzeneacetic acid, alpha,2-dichloro-, methyl ester ; and Methyl chloro(2-chlorophenyl)acetate . |
| Flash Point: | 110.699°C |
| Safety Data | |
 |
|
