| Identification | |
| Name: | Methacrylic acid, acrylonitrile, butadiene polymer |
| Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with 1,3-butadiene and 2-propenenitrile;1,3-Butadiene, acrylonitrile, methacrylic acid polymer;Acrylonitrile, butadiene, methacrylic acid terpolymer;Acrylonitrile/1,3-butadiene/methacrylic acid copolymer |
| CAS: | 9010-81-5 |
| Molecular Formula: | C11H15NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H6O2.C4H6.C3H3N/c1-3(2)4(5)6;1-3-4-2;1-2-3-4/h1H2,2H3,(H,5,6);3-4H,1-2H2;2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 74.2°C |
| Boiling Point: | 160.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 74.2°C |
| Safety Data | |
 |
|
