| Identification |
| Name: | 1,3-Butadiene, 2-methyl-, polymer with 2-methyl-1-propene |
| Synonyms: | Brominated butyl rubberValid heading during volumes 126-130 (1997-June1999) only;Isoprene, polymer with 2-methylpropene (8CI);2-Methyl-1,3-butadiene polymer with 2-methyl-1-propene;PB 100 (polymer);1,3-Butadiene,2-methyl-,polymers,polymer with 2-methyl-1-propene;Poly(isobutylene-co-isoprene);LM Butyl;Butyl rubber;Isobutylene/isoprene copolymer;PB 600;Butyl rubberIsobutylene-isoprene copolymers are indexed here;Fine particle rubber;Isobutylene-isoprene elastomer; |
| CAS: | 9010-85-9 |
| Molecular Formula: | (C5H8.C4H8)x |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H8.C4H8/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;1H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | 34.1°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data |
| |
 |
