| Identification | |
| Name: | Urea, polymer with formaldehyde |
| Synonyms: | Micrea;KyliteKymene 435;S 40 (aminoplast);MM 54V;W 436;KS 35;VF Filler;Resimene X 980;U-Loid S 22;BU 286;U-Pearl C 122R;Kaurit 471;Acrisin FS 017;Diakol DM;Knittex TC;UA 143;Beckamine P 196M;Aerolite A 300;Moform 50;AL 3029;MPF 2;EMG;UM-G;KF 02;P 196-60;Polyfix UC 30M;Laropal A 101;A 2 (aminoplast);M 60 (formaldehyde polymer); |
| CAS: | 9011-05-6 |
| Molecular Formula: | (CH4N2O.CH2O)x |
| Molecular Weight: | 120.11 |
| InChI: | InChI=1/CH4N2O.CH2O/c2-1(3)4;1-2/h(H4,2,3,4);1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Solubility: | Solubility in water = 0.28-0.31% |
| Appearance: | white or colored |
| Specification: | CAS DataBase Reference9011-05-6(CAS DataBase Reference)EPA Substance Registry SystemUrea, polymer with formaldehyde(9011-05-6) Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Color: | Amorphous powder |
| Safety Data | |
 |
|
