| Identification | |
| Name: | (R)-Methyl 2-hydroxy-3-methylbutanoate |
| Synonyms: | Butanoic acid, 2-hydroxy-3-methyl-, methyl ester, (2R)-;Methyl (2R)-2-hydroxy-3-methylbutanoate; |
| CAS: | 90244-32-9 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-4(2)5(7)6(8)9-3/h4-5,7H,1-3H3/t5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 57.2°C |
| Boiling Point: | 165.6°C at 760 mmHg |
| Density: | 1.021g/cm3 |
| Refractive index: | 1.425 |
| Specification: |
The IUPAC name of (R)-Methyl 2-hydroxy-3-methylbutanoate is methyl (2R)-2-hydroxy-3-methylbutanoate. With the CAS registry number 90244-32-9, it is also named as Butanoic acid, 2-hydroxy-3-methyl-, methyl ester, (2R)-. In addition, its molecular formula is C6H12O3 and its molecular weight is 132.16. The other characteristics of (R)-Methyl 2-hydroxy-3-methylbutanoate can be summarized as: (1)ACD/LogP: 0.16; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.16; (4)ACD/LogD (pH 7.4): 0.16; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 29.1; (8)ACD/KOC (pH 7.4): 29.1; (9)H bond acceptors: 3; (10)H bond donors: 1; (11)Freely Rotating Bonds: 4; (12)Polar Surface Area: 35.53 Å2; (13)Index of Refraction: 1.425; (14)Molar Refractivity: 33.07 cm3; (15)Molar Volume: 129.3 cm3; (16)Polarizability: 13.11×10-24cm3; (17)Surface Tension: 31.8 dyne/cm; (18)Density: 1.021 g/cm3; (19)Flash Point: 57.2 °C; (20)Enthalpy of Vaporization: 46.82 kJ/mol; (21)Boiling Point: 165.6 °C at 760 mmHg; (22)Vapour Pressure: 0.622 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Flash Point: | 57.2°C |
| Safety Data | |
 |
|
