| Identification | |
| Name: | 1H-Indole,4-chloro-5-fluoro-2,3-dihydro- |
| Synonyms: | 4-Chloro-5-fluoro-2,3-dihydro-1H-indole |
| CAS: | 903551-32-6 |
| Molecular Formula: | C8H7ClFN |
| Molecular Weight: | 171.6 |
| InChI: | InChI=1/C8H7ClFN/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-2,11H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.7°C |
| Boiling Point: | 259.5°C at 760 mmHg |
| Density: | 1.312g/cm3 |
| Refractive index: | 1.556 |
| Specification: |
The 4-Chloro-5-fluoroindoline, with the CAS registry number 903551-32-6, is also known as 4-Chloro-5-fluoro-2,3-dihydro-1H-indole. This chemical's molecular formula is C8H7ClFN and molecular weight is 171.60. Its systematic name is called 4-chloro-5-fluoroindoline. Physical properties of 4-Chloro-5-fluoroindoline: (1)ACD/LogP: 3.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.29; (4)ACD/LogD (pH 7.4): 3.31; (5)#H bond acceptors: 1; (6)#H bond donors: 1; (7)Index of Refraction: 1.556; (8)Molar Refractivity: 42.05 cm3; (9)Molar Volume: 130.7 cm3; (10)Surface Tension: 40.2 dyne/cm; (11)Density: 1.312 g/cm3; (12)Flash Point: 110.7 °C; (13)Enthalpy of Vaporization: 49.71 kJ/mol; (14)Boiling Point: 259.5 °C at 760 mmHg; (15)Vapour Pressure: 0.0129 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 110.7°C |
| Safety Data | |
 |
|
