Identification |
Name: | Oxirane, 2-methyl-,polymer with oxirane, monobutyl ether |
Synonyms: | Glycols,polyethylene-polypropylene, monobutyl ether (8CI); Oxirane, methyl-, polymerwith oxirane, monobutyl ether (9CI); Oxirane, polymer with methyloxirane,monobutyl ether (9CI); 50HB260; 50HB5100; 50HB55; 50MB5; B 11/150; B 11/300; B11/50; B 11/50 (polyoxyalkylene); Bel-Ray Syncom 1400; Breox 50A20; Breox50A20S; Breox 50A380; Butanol-ethylene oxide-propylene oxide adduct; Butoxypolyoxyethylene oxypropylene glycol; Butoxypolyethylenepolypropyleneglycol;Butoxyslovanik BK 61; DCP 101; Emkarox VG 680W; Emulgen V 40; Ethyleneglycol-propylene glycol polymer butyl ether; Ethylene oxide-propylene oxidecopolymer butyl ether; Ethylene oxide-propylene oxide copolymer ether withn-butanol; Ethylene oxide-propylene oxide copolymer mono-n-butyl ether; Ethyleneoxide-propylene oxide copolymer monobutyl ether; Ethylene oxide-propylene oxidepolymer monobutyl ether; FTD 89; Jeffox WL 5000; Jeffox WL 660; Macol 300;Macol 5100; Methyloxirane-oxirane copolymer monobutyl ether; Newpol 50HB100;Newpol 50HB2000; Newpol 50HB260; Newpol 50HB5100; Newpol 50HB5100S; Newpol50HB55; Newpol 50HB600; Nissan Disfoam CK 140; Nissan Unilube 50MB11; NissanUnilube 50MB168; Nissan Unilube 50MB168L; Nissan Unilube 50MB168R; NissanUnilube 50MB26; Nissan Unilube 50MB5; Nissan Unilube 50MB72; Nissan Unilube C;Oxyethylene-oxypropylene copolymer monobutyl ether; PPG-26-buteth-26;PPG-5-buteth-7; PPG-buteth; Pionin P 1050B; Pluracol W 3520N; Pluriol A 1000PE;Pluriol A 2300PE; Poly(propylene oxide-ethylene oxide) butyl ether; Polyethyleneglycol-polypropylene glycol monobutyl ether; Polyethylene polypropylene glycolbutyl ether; Polyethylene-polypropylene glycol monobutyl ether; Polyglycol B11/300; Polyglycol B 11/700; Polyglykol B 11/50; Polyhydroxyethyleneoxypropylene monobutyl ether; Polykol B 11/50; Polyoxyethylene polyoxyropylenemonobutyl ether; Polyoxyethylene-polyoxypropylene monobutyl ether; Synalox EPB660; Tergitol XD; Ucon 50-660; Ucon 50HB100; Ucon 50HB2000; Ucon 50HB260; Ucon50HB3520; Ucon 50HB400; |
CAS: | 9038-95-3 |
Molecular Formula: | C4 H10 O |
Molecular Weight: | 248.35902 |
InChI: | InChI=1S/C13H28O4/c1-4-5-8-15-10-11-16-12-13(2)17-9-6-7-14-3/h13H,4-12H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3082 9 |
Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. |
Refractive index: | n20/D 1.46 |
Water Solubility: | H2O: at |
Appearance: | liquid |
Safety Data |
Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
|
 |