Identification |
Name: | 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
Synonyms: | 2,5-Di(1-naphthyl)-1,3,4-oxadiazole |
CAS: | 905-62-4 |
EINECS: | 212-995-0 |
Molecular Formula: | C22H14N2O |
Molecular Weight: | 322.36 |
InChI: | InChI=1/C22H14N2O/c1-3-11-17-15(7-1)9-5-13-19(17)21-23-24-22(25-21)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
Molecular Structure: |
 |
Properties |
Melting Point: | 175-178°C |
Flash Point: | 293.1°C |
Boiling Point: | 556.4°Cat760mmHg |
Density: | 1.251g/cm3 |
Refractive index: | 1.7 |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 293.1°C |
Safety Data |
|
 |