Identification |
Name: | Oxirane, methyl-, polymer with 1,3-diisocyanatomethylbenzene and oxirane |
Synonyms: | Oxirane, methyl-, polymer with 1,3-diisocyanatomethylbenzene and oxirane |
CAS: | 9052-50-0 |
Molecular Formula: | C14H16N2O4 |
Molecular Weight: | 276.28784 |
InChI: | InChI=1S/C9H6N2O2.C3H6O.C2H4O/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;1-3-2-4-3;1-2-3-1/h2-4H,1H3;3H,2H2,1H3;1-2H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 110.5°C |
Boiling Point: | 248.4°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 110.5°C |
Safety Data |
|
 |