| Identification | |
| Name: | Boronic acid,B-(3-ethylphenyl)- |
| Synonyms: | Benzeneboronicacid, m-ethyl- (7CI); Boronic acid, (3-ethylphenyl)- (9CI);3-Ethylphenylboronic acid |
| CAS: | 90555-65-0 |
| Molecular Formula: | C8H11 B O2 |
| Molecular Weight: | 149.98 |
| InChI: | InChI=1/C8H11BO2/c1-2-7-4-3-5-8(6-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 102.5-107.5 C |
| Flash Point: | 135°C |
| Boiling Point: | 299.6°Cat760mmHg |
| Density: | 1.07g/cm3 |
| Refractive index: | 1.521 |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 135°C |
| Safety Data | |
 |
|
