| Identification | |
| Name: | Acrylic polymers |
| Synonyms: | Acrylonitrilepolymers (including copolymers); Acrylate polymers; Acrylic plastics; Acrylicpolymer; Acrylic resin; Acrylic resins; Acrylics; Eudragit RTM; Plastics,acrylic; Polyacrylic resins; Polyacrylics |
| CAS: | 9065-11-6 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -47.55 deg C |
| Boiling Point: | 100.5 deg C |
| Density: | 0.914 g/cm3 |
| Solubility: | Soluble in methyl ethyl ketone, tetrahydrofuran, esters, aromatic and chlorinated hydrocarbons Miscible with ethanol, ethyl ether, acetone; soluble in chloroform 1.500 lb/100 lb water at 68.02 deg F Sol in chloroform 1.6 parts by wt/100 parts by wt of water at room temp 1.5 g/100 g water at 30 deg C Soluble in most organic solvents In water, 1.57X10+4 mg/L at 20 deg C |
| Color: | Colorless volatile liquid |
| Safety Data | |
 |
|
