| Identification | |
| Name: | 3-Pyridinol, 2-methyl-,hydrochloride (1:1) |
| Synonyms: | 3-Pyridinol,2-methyl-, hydrochloride (7CI); |
| CAS: | 90724-46-2 |
| Molecular Formula: | C6H7NO.HCl |
| Molecular Weight: | 145.59 |
| InChI: | InChI=1/C6H7NO.ClH/c1-5-6(8)3-2-4-7-5;/h2-4,8H,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 3-Hydroxy-2-methylpyridine hydrochloride is an organic compound with the formula C6H7NO.HCl. The systematic name of this chemical is 2-methylpyridin-3-ol hydrochloride. With the CAS registry number 90724-46-2, it is also named as N-Methylsulfonyl-tyramine. Physical properties about 3-Hydroxy-2-methylpyridine hydrochloride are: (1)ACD/LogP: 1.10; (2)ACD/LogD (pH 5.5): 0.47; (3)ACD/LogD (pH 7.4): 0.72; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1.66; (6)ACD/KOC (pH 5.5): 22.14; (7)ACD/KOC (pH 7.4): 38.97; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 22.12 Å2; (12)Flash Point: 127.4 °C; (13)Enthalpy of Vaporization: 54.74 kJ/mol; (14)Boiling Point: 287.1 °C at 760 mmHg; (15)Vapour Pressure: 0.00147 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
