| Identification | |
| Name: | 2-Benzoylpyridine;Phenyl 2-pyridyl ketone |
| Synonyms: | Ketone,phenyl 2-pyridyl (6CI,7CI,8CI); 2-Benzoylpyridine; 2-Pyridyl phenyl ketone; NSC20887; Phenyl 2-pyridyl ketone; Phenyl(2-pyridinyl)methanone |
| CAS: | 91-02-1 |
| EINECS: | 202-034-3 |
| Molecular Formula: | C12H9NO |
| Molecular Weight: | 183.21 |
| InChI: | InChI=1/C12H9NO/c14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.139g/cm3 |
| Refractive index: | 1.588 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | White to pale yellowish crystals |
| Specification: | COLOURLESS TO SLIGHTLY YELLOW CRYSTALLINE CHUNKS Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29333999 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
