| Identification | |
| Name: | 1,3-Benzenedimethanol,2-hydroxy-5-methyl- |
| Synonyms: | a1,a3-Mesitylenediol,2-hydroxy- (6CI,7CI,8CI); 2,6-Bis(hydroxymethyl)-4-methylphenol;2,6-Bis(hydroxymethyl)-p-cresol; 2,6-Di(hydroxymethyl)-p-cresol;2,6-Dimethylol-4-methylphenol; 2,6-Dimethylol-p-cresol;2-Hydroxy-5-methyl-1,3-benzenedimethanol;4-Methyl-2,6-bis(hydroxymethyl)phenol; DML-PC; NSC 15838; a1,a3,2-Trihydroxymesitylene |
| CAS: | 91-04-3 |
| EINECS: | 202-036-4 |
| Molecular Formula: | C9H12 O3 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C9H12O3/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2-3,10-12H,4-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.276 g/cm3 |
| Refractive index: | 1.613 |
| Appearance: | light pink crystalline powder |
| Specification: |
3,5-Bis(hydroxymethyl)-p-cresol with CAS registry number of 91-04-3 is yellow-brown - brown crystalline powder. It is incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . 3,5-Bis(hydroxymethyl)-p-cresol is also known as 2,6-Bis(hydroxymethyl)-4-methylphenol ; 2,6-Bis(hydroxymethyl)-p-cresol ; 2,6-Di(hydroxymethyl)-p-cresol ; 2,6-Dimethylol-4-methylphenol ; 2,6-Dimethylol-p-cresol ; 2-Hydroxy-5-methyl-1,3-benzenedimethanol ; 4-06-00-07411 (Beilstein Handbook Reference) ; NSC 15838 ; alpha(sup 1),alpha(sup 3),2-Trihydroxymesitylene ; alpha1,alpha,2-Trihydroxymesitylene ; 1,3-Benzenedimethanol, 2-hydroxy-5-methyl- ; alpha(sup 1),alpha(sup 3)-Mesitylenediol, 2-hydroxy- (7CI,8CI) ; alpha1,alpha3-Mesitylenediol, 2-hydroxy- (8CI) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
