| Identification | |
| Name: | 2-methyl-m-phenylene diisocyanate |
| Synonyms: | Toluene-2,6-diisocyanate; 2,6-Diisocyanato-1-methylbenzene |
| CAS: | 91-08-7 |
| EINECS: | 202-039-0 |
| Molecular Formula: | C9H6N2O2 |
| Molecular Weight: | 174.156 |
| InChI: | InChI=1/C9H6N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2078 6.1/PG 2 |
| Melting Point: | 20 |
| Flash Point: | 110 |
| Boiling Point: | 248.4 at 760 mm Hg |
| Density: | 1.14 |
| Stability: | Stability Reacts violently with water. Reacts very rapidly with compounds containing an active hydrogen, such as amines, alcohols and acids. Polymerizes rapidly in the presence of base. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.571(lit.) |
| Solubility: | Decomposes in water Soluble in acetone, benzene |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Flash Point: | 110 |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Color: | White to pale yellow liquid |
| Safety Data | |
 |
|
