| Identification | |
| Name: | Benzeneacetic acid, a-(phenylmethylene)-, (aE)- |
| Synonyms: | Acrylicacid, 2,3-diphenyl-, (E)- (8CI);Acrylic acid, 2,3-diphenyl-, trans- (5CI);Benzeneacetic acid, a-(phenylmethylene)-, (E)-;(E)-2,3-Diphenyl-2-propenoic acid;(E)-2,3-Diphenylacrylic acid;(E)-2,3-Diphenylpropenoic acid;(E)-a-(Phenylmethylene)benzeneaceticacid;(E)-a-Phenylcinnamic acid;(E)-a-Stilbenecarboxylic acid;2,3-Diphenylacrylic acid;trans-2,3-Diphenyl-2-propenoic acid;trans-2,3-Diphenylacrylic acid;trans-2,3-Diphenylpropenoic acid;trans-a-Phenylcinnamic acid; |
| CAS: | 91-48-5 |
| EINECS: | 202-069-4 |
| Molecular Formula: | C15H12O2 |
| Molecular Weight: | 224.25458 |
| InChI: | InChI=1S/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.198 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any toxic |
| Solubility: |
|
| Appearance: | light yellow powder |
| Safety Data | |
 |
|
