| Identification | |
| Name: | Acetamide,N-butyl-N-phenyl- |
| Synonyms: | Acetanilide,N-butyl- (6CI,7CI,8CI); BAA; Butylacetanilide; N-Butylacetanilide;N-n-Butylacetanilide; NSC 7662 |
| CAS: | 91-49-6 |
| EINECS: | 202-071-5 |
| Molecular Formula: | C12H17 N O |
| Molecular Weight: | 191.27 . CODE |
| InChI: | InChI=1/C12H17NO/c1-3-4-10-13(11(2)14)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 21 C |
| Flash Point: | 141 C |
| Boiling Point: | 273 - 275 C |
| Density: | 0.9303 g/cm3 (16 C) |
| Stability: | No data. |
| Refractive index: | 1.4693 (16 C) |
| Solubility: |
2, dry chemical. When heated to decomposition it emits toxic fumes of NOx. |
| Appearance: | clear to yellow liquid |
| Specification: |
N-Butylacetanilide (91-49-6) also can be called Acetyl-N-butylaniline ; Acetamide, N-butyl-N-phenyl- ; N-Butyl-N-phenylacetamide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 141 C |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Usage: | Used as a repellant for control of ticks & fleas. |
| Safety Data | |
| Hazard Symbols | |
 |
|
