Identification |
Name: | 1H-Indole-2,3-dione |
Synonyms: | Indole-2,3-dione(8CI);2,3-Dihydro-1H-indole-2,3-dione;2,3-Dihydroindole-2,3-dione;2,3-Diketoindoline;2,3-Dioxo-2,3-dihydroindole;2,3-Dioxoindoline;2,3-Indolindione;2,3-Indolinedione;Isatic acid lactam;Isatin;Isatine;Isatinic acid anhydride;NSC 9262;Pseudoisatin;o-Aminobenzoylformic anhydride; |
CAS: | 91-56-5 |
EINECS: | 202-077-8 |
Molecular Formula: | C8H5NO2 |
Molecular Weight: | 147.13 |
InChI: | InChI=1/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11) |
Molecular Structure: |
![(C8H5NO2) Indole-2,3-dione(8CI);2,3-Dihydro-1H-indole-2,3-dione;2,3-Dihydroindole-2,3-dione;2,3-Diketoindoline...](https://img.guidechem.com/casimg/91-56-5.gif) |
Properties |
Transport: | 25kgs |
Density: | 1.367 g/cm3 |
Stability: | Stable. Incompatible with strong acids. |
Refractive index: | 1.661 |
Water Solubility: | Slightly soluble SOLVENT AUTOIGNITION |
Solubility: | Slightly soluble SOLVENT AUTOIGNITION |
Appearance: | yellow to reddish crystalline solid |
Packinggroup: | III |
HS Code: | 29337900 |
Storage Temperature: | Store at RT. |
Usage: | Production of vat dyes. |
Safety Data |
Hazard Symbols |
|
|
![](/images/detail_15.png) |