| Identification |
| Name: | B-naphthylamine isopac |
| Synonyms: | 2-Naphthylamine; 2-Aminonaphthalene; beta-Naphthylamine; C.I.37270; Fast Scarlet Base B |
| CAS: | 91-59-8 |
| EINECS: | 202-080-4 |
| Molecular Formula: | C10H9N |
| Molecular Weight: | 143.19 |
| InChI: | InChI=1/C10H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,11H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1650 |
| Density: | 1.061 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.6493 (98 C) |
| Water Solubility: | Soluble
(soluble
in alcohol and ether) |
| Solubility: | Soluble
(soluble
in alcohol and ether)
|
| Appearance: | yellow
powder |
| Packinggroup: | II |
| Storage Temperature: | Keep in cool dry location away from ignition sources. |
| Color: | pink to purple |
| Usage: | It is listed as a known human carcinogen. Used in manufacturing of dyes, as antioxidant in rubber |
| Safety Data |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
| |
 |
