| Identification | ||
| Name: | 3-Hydroxy-N,N-diethylaniline | |
| Synonyms: | 3-diethylaminophenol; N,N-Diethyl-3-aminophenol | |
| CAS: | 91-68-9 | |
| EINECS: | 202-090-9 | |
| Molecular Formula: | C10H15NO | |
| Molecular Weight: | 165.23 | |
| InChI: | InChI=1/C10H15NO/c1-3-11(4-2)9-6-5-7-10(12)8-9/h5-8,12H,3-4H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2512 | |
| Density: | 1.04g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.564 | |
| Water Solubility: | <0.1 g/100 mL at 20.5 ºC | |
| Solubility: | <0.1 g/100 mL at 20.5 oC | |
| Appearance: | Black solid. | |
| Specification: | Grey-brown to rose or red flakes or granules Safety Statements:36/37/39-45-22-26-36 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing | |
| Packinggroup: | III | |
| HS Code: | 29222900 | |
| Storage Temperature: | Refrigerator | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
