| Identification | |
| Name: | 66019-18-9 |
| Synonyms: | 2-Propenoic acid, telomer with sodium hydrogen sulfite, sodium salt;Acrylic acid sodium salt polymer, sodium sulfonate terminated;2-Propenoic acid, telomer with sodium sulfite (1:1), sodium salt;LS-195616;Polyacrylic acid, sodium bisulfite terminated;2-Propenoic acid, telomer with sodium hydrogen sulfite;2-Propenoic acid, telomer with sodium sulfite (1:1);Acrylic acid sodium hydrogen sulfite telomer sodium salt;159479-98-8;161050-16-4;66019-18-9;68479-09-4;91144-29-5 |
| CAS: | 91144-29-5 |
| Molecular Formula: | C3H5NaO5S |
| Molecular Weight: | 176.12357 |
| InChI: | InChI=1S/C3H4O2.Na.H2O3S/c1-2-3(4)5;;1-4(2)3/h2H,1H2,(H,4,5);;(H2,1,2,3)/q;+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 61.6°C |
| Safety Data | |
 |
|
