| Identification | |
| Name: | Benzenamine, 4-azido-,hydrochloride (1:1) |
| Synonyms: | Aniline,p-azido-, hydrochloride (7CI); Benzenamine, 4-azido-, monohydrochloride (9CI);4-Azidoaniline hydrochloride; 4-Azidophenylammonium chloride |
| CAS: | 91159-79-4 |
| EINECS: | 238-929-0 |
| Molecular Formula: | C6H6 N4 . Cl H |
| Molecular Weight: | 170.6 |
| InChI: | InChI=1/C6H6N4.ClH/c7-5-1-3-6(4-2-5)9-10-8;/h1-4H,7H2;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2926 4.1/PG 2 |
| Melting Point: | 165 °C (dec.)(lit.) |
| Specification: | Safety Statements:16-26-33-36/37-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 33:Take precautionary measures against static discharges 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
F: Flammable
T: Toxic
|
 |
|
