| Identification | |
| Name: | 4,5-Bis(2-butenyloxy)-2-imidazolidinone |
| Synonyms: | 4,5-bis[(E)-but-2-enoxy]imidazolidin-2-one |
| CAS: | 91216-69-2 |
| Molecular Formula: | C11H18N2O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H18N2O3/c1-3-5-7-15-9-10(13-11(14)12-9)16-8-6-4-2/h3-6,9-10H,7-8H2,1-2H3,(H2,12,13,14)/b5-3+,6-4+ |
| Molecular Structure: | ![(C11H18N2O3) 4,5-bis[(E)-but-2-enoxy]imidazolidin-2-one](https://img.guidechem.com/crawlimg/91216-69-2.png) |
| Properties | |
| Flash Point: | 209.4°C |
| Boiling Point: | 422.6°C at 760 mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.513 |
| Specification: |
4,5-Bis(2-butenyloxy)-2-imidazolidinone ,its CAS number is 91216-69-2,it can be called 2-Imidazolidinone, 4,5-bis(2-butenyloxy)- . It is a moderate toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides,so it should be stored in cool and dry environment.Dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 209.4°C |
| Safety Data | |
 |
|
