| Identification | |
| Name: | 6-Methyl-2-heptyl-isopropylidenhydrazin |
| Synonyms: | KR 492;6-Methyl-2-heptyl-isopropylidenhydrazin [German];ACETONE, 1-(6-METHYLHEPT-2-YL)HYDRAZONE;Hydrazine, 1-isopropylidene-2-(1,5-dimethylhexyl)-;6-Methyl-2-heptyl-isopropylidenhydrazin;LS-13193;91336-54-8 |
| CAS: | 91336-54-8 |
| Molecular Formula: | C11H24N2 |
| Molecular Weight: | 184.3217 |
| InChI: | InChI=1/C11H24N2/c1-9(2)6-5-7-10(3)8-11(4)13-12/h9-10H,5-8,12H2,1-4H3/b13-11+ |
| Molecular Structure: | ![(C11H24N2) KR 492;6-Methyl-2-heptyl-isopropylidenhydrazin [German];ACETONE, 1-(6-METHYLHEPT-2-YL)HYDRAZONE;Hydr...](https://img.guidechem.com/crawlimg/91336-54-8.png) |
| Properties | |
| Flash Point: | 115.221°C |
| Boiling Point: | 266.906°C at 760 mmHg |
| Density: | 0.888g/cm3 |
| Refractive index: | 1.466 |
| Specification: |
6-Methyl-2-heptyl-isopropylidenhydrazin , its cas register number is 91336-54-8. It also can be called Hydrazine, 1-isopropylidene-2-(1,5-dimethylhexyl)- ; KR 492 . When 6-Methyl-2-heptyl-isopropylidenhydrazin (CAS NO.91336-54-8) is heated to decomposition, it emits toxic fumes of NOx. |
| Flash Point: | 115.221°C |
| Safety Data | |
 |
|
