| Identification | |
| Name: | 4-Bromo-1H-indazol-3-amine |
| Synonyms: | 3-Amino-4-bromo-1H-indazole;1H-indazol-3-amine, 4-bromo-; |
| CAS: | 914311-50-5 |
| Molecular Formula: | C7H6BrN3 |
| Molecular Weight: | 212.05 |
| InChI: | InChI=1/C7H6BrN3/c8-4-2-1-3-5-6(4)7(9)11-10-5/h1-3H,(H3,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.867 g/cm3 |
| Refractive index: | 1.8 |
| Specification: |
The 4-Bromo-1H-indazol-3-amine with the cas number 914311-50-5, is also called 3-Amino-4-bromo-1H-indazole. The product can be supplied by the following suppliers: (1)BePharm,Ltd.; (2)Ark Pharm, Inc.; (3)Shanghai Yuanding Chem. Sci. & Tech. Co., Ltd. ; (4)B&S Group (Asia) Ltd.; (5)Beta Pharma, Inc.. The properties of the chemical are: (1)ACD/LogP: 2.22; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 54.7 Å2; (7)Index of Refraction: 1.8; (8)Molar Refractivity: 48.546 cm3; (9)Molar Volume: 113.56 cm3; (10)Polarizability: 19.245×10-24cm3; (11)Surface Tension: 81.483 dyne/cm; (12)Enthalpy of Vaporization: 68.695 kJ/mol; (13)Vapour Pressure: 0 mmHg at 25°C . You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
