| Identification | |
| Name: | 4-Thiazolecarboxylicacid, 5-bromo-2-phenyl-, ethyl ester |
| Synonyms: | Ethyl 5-bromo-2-phenylthiazole-4-carboxylate; |
| CAS: | 914347-21-0 |
| Molecular Formula: | C12H10BrNO2S |
| Molecular Weight: | 312.18 |
| InChI: | InChI=1/C12H10BrNO2S/c1-2-16-12(15)9-10(13)17-11(14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200.6°C |
| Boiling Point: | 408°C at 760 mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.602 |
| Specification: |
The 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester with cas registry number of 914347-21-0, belongs to the following product categorie: API intermediates. And it is also called Ethyl 5-bromo-2-phenylthiazole-4-carboxylate. |
| Flash Point: | 200.6°C |
| Safety Data | |
 |
|
