| Identification | |
| Name: | 4-Piperidinemethanol,1-(4-pyridinylmethyl)- |
| Synonyms: | 1-((Pyridin-4-yl)methyl)piperidin-4-yl)methanol |
| CAS: | 914349-22-7 |
| Molecular Formula: | C12H18N2O |
| Molecular Weight: | 206.28 |
| InChI: | InChI=1/C12H18N2O/c15-10-12-3-7-14(8-4-12)9-11-1-5-13-6-2-11/h1-2,5-6,12,15H,3-4,7-10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.099 |
| Refractive index: | 1.554 |
| Specification: |
1-(4-Pyridinylmethyl)-4-piperidinemethanol is a kind of Pharmaceutical intermediates with cas registry number of 914349-22-7. Its systematic name is [1-(Pyridin-4-ylmethyl)piperidin-4-yl]methanol . Besides this, it is also called 1-((Pyridin-4-yl)methyl)piperidin-4-yl)methanol . About its structure, there are some characters: H bond acceptors: 3, H bond donors: 1, Freely Rotating Bonds: 4. Meanwhile, its SMILES and InChI is very useful which are OCC2CCN(Cc1ccncc1)CC2 and InChI=1/C12H18N2O/c15-10-12-3-7-14(8-4-12)9-11-1-5-13-6-2-11/h1-2,5-6,12,15H,3-4,7-10H2. Some other physical properties of 1-(4-Pyridinylmethyl)-4-piperidinemethanol include: (1) Index of Refraction: 1.554, (2) Molar Refractivity: 60.112 cm3, (3) Molar Volume: 187.613 cm3, (4) Surface Tension: 47.089 dyne/cm, (5) Enthalpy of Vaporization: 61.339 kJ/mol. As a commercial product, 1-(4-Pyridinylmethyl)-4-piperidinemethanol is offered by many suppliers such as Hotechem Shanghai Co., Ltd., Tongzhou Chengxin Amino Acid Co., Ltd.. You can get it easily in the market. |
| Safety Data | |
 |
|
