| Identification | |
| Name: | Benzoic acid,3-(2-amino-5-pyrimidinyl)- |
| Synonyms: | 3-(2-Aminopyrimidin-5-yl)benzoic acid; |
| CAS: | 914349-45-4 |
| Molecular Formula: | C11H9N3O2 |
| Molecular Weight: | 215.21 |
| InChI: | InChI=1/C11H9N3O2/c12-11-13-5-9(6-14-11)7-2-1-3-8(4-7)10(15)16/h1-6H,(H,15,16)(H2,12,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.379 |
| Refractive index: | 1.668 |
| Specification: |
The 3-(2-Aminopyrimidin-5-yl)benzoic acid with the CAS number 914349-45-4 is also called Benzoic acid,3-(2-amino-5-pyrimidinyl)-. Its molecular formula is C11H9N3O2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 3-(2-Aminopyrimidin-5-yl)benzoic acid are: (1)ACD/LogP: 1.48; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 5; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 89.1 Å2; (7)Index of Refraction: 1.668; (8)Molar Refractivity: 58.19 cm3; (9)Molar Volume: 155.9 cm3; (10)Polarizability: 23.06×10-24cm3; (11)Surface Tension: 73.6 dyne/cm; (12)Enthalpy of Vaporization: 87.69 kJ/mol; (13)Vapour Pressure: 4.75×10-13 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
