Specification: |
The (2S)-2-Amino-N-(2,2,2-trifluoroethyl)propanamide hydrochloride with the cas number 916176-69-7 is also called N-(2,2,2-Trifluoroethyl)-L-alaninamide hydrochloride (1:1). The systematic name is propanamide, 2-amino-N-(2,2,2-trifluoroethyl)-, (2S)-, hydrochloride (1:1). Its molecular formula is C5H9F3N2O.HCl. This chemical is a kind of organics. It should be stored in dry and cool environment.
You can still convert the following datas into molecular structure:
(1)SMILES: C[C@@H](C(=O)NCC(F)(F)F)N.Cl
(2)InChI: InChI=1/C5H9F3N2O.ClH/c1-3(9)4(11)10-2-5(6,7)8;/h3H,2,9H2,1H3,(H,10,11);1H/t3-;/m0./s1
(3)InChIKey: HFUCVVCJXREYJQ-DFWYDOINBC
|