Identification |
Name: | Xanthylium,9-(2,5-dicarboxyphenyl)-3,6-bis(dimethylamino)-, inner salt |
Synonyms: | 6-Carboxytetramethylrhodamine;N,N,N',N'-Tetramethyl-6-carboxyrhodamine |
CAS: | 91809-67-5 |
Molecular Formula: | C25H22 N2 O5 |
Molecular Weight: | 430.46 |
InChI: | InChI=1/C25H22N2O5/c1-26(2)15-6-9-18-21(12-15)32-22-13-16(27(3)4)7-10-19(22)23(18)20-11-14(24(28)29)5-8-17(20)25(30)31/h5-13H,1-4H3,(H-,28,29,30,31) |
Molecular Structure: |
|
Properties |
Melting Point: | NA |
Water Solubility: | DMSO: soluble |
Solubility: | DMSO:soluble |
Specification: |
6-Carboxytetramethylrhodamine , its cas register number is 91809-67-5. It also can be called 6-Tamra ; 6-Carboxytetramethylrhodamine .
|
Usage: |
6-Carboxytetramethylrhodamine (CAS NO.91809-67-5) can be used as a long-wavelength dye.
|
Safety Data |
|
|