| Identification | |
| Name: | 5-Isothiazolamine,4-methyl-3-phenyl- |
| Synonyms: | Isothiazole,5-amino-4-methyl-3-phenyl- (7CI); |
| CAS: | 91818-68-7 |
| Molecular Formula: | C10H10N2S |
| Molecular Weight: | 190.26 |
| InChI: | InChI=1/C10H10N2S/c1-7-9(12-13-10(7)11)8-5-3-2-4-6-8/h2-6H,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.219 g/cm3 |
| Refractive index: | 1.642 |
| Specification: |
The 4-Methyl-3-phenylisothiazol-5-amine, its cas register number is 91818-68-7. It also can be called as 5-Isothiazolamine,4-methyl-3-phenyl- and the Systematic name about this chemical is 4-Methyl-3-phenylisothiazol-5-amine. Following are the chemical properties about 4-Methyl-3-phenylisothiazol-5-amine: (1)#H bond acceptors: 2; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 67.15Å2; (5)Index of Refraction: 1.642; (6)Molar Refractivity: 56.38 cm3; (7)Molar Volume: 155.9 cm3; (8)Polarizability: 22.35x10-24cm3; (9)Surface Tension: 53.2 dyne/cm; (10)Enthalpy of Vaporization: 49.08 kJ/mol; (11)Vapour Pressure: 0.0183 mmHg at 25°C This chemical can be described computed from structure: |
| Safety Data | |
 |
|
