| Identification | |
| Name: | [1,1'-Biphenyl]-4-ol,3-chloro- |
| Synonyms: | 4-Biphenylol,3-chloro- (8CI); Phenol, 2-chloro-4-phenyl- (6CI,7CI); 2-Chloro-4-phenylphenol;2-Chloro-p-phenylphenol; 3-Chloro-4-biphenylol; 3-Chloro-4-hydroxybiphenyl;4-Hydroxy-3-chlorobiphenyl; 4-Phenyl-2-chlorophenol; Dowicide 4; NSC 3858;Sanidril; o-Chloro-p-phenylphenol |
| CAS: | 92-04-6 |
| EINECS: | 202-120-0 |
| Molecular Formula: | C12H9 Cl O |
| Molecular Weight: | 204.65 |
| InChI: | InChI=1/C12H9ClO/c13-12-8-10(14)6-7-11(12)9-4-2-1-3-5-9/h1-8,14H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 75°C |
| Flash Point: | 144.6°C |
| Boiling Point: | 315.4°C at 760 mmHg |
| Density: | 1.239g/cm3 |
| Refractive index: | 1.615 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. Chlorophenol compounds are on the Community Right-To-Know List. |
| Flash Point: | 144.6°C |
| Safety Data | |
 |
|
