| Identification | |
| Name: | Butanamide,N-(2-methoxyphenyl)-3-oxo- |
| Synonyms: | o-Acetoacetanisidide(6CI,7CI,8CI);1-Acetoacetylamino-2-methoxybenzene;2-(Acetoacetylamino)anisole;2'-Methoxyacetoacetanilide;Acetoacet-2-anisidide;Acetoacetic acid 2-anisidide;Acetoacetic acid 2-methoxyanilide;Acetoaceticacid o-anisidide;Acetoaceto-o-anisidide;Acetoacetyl-o-anisidide;Acetoacetyl-o-anisidine;N-(2-Methoxyphenyl)-3-oxobutanamide;N-Acetoacetyl-o-anisidine;NSC 7563;o-Methoxyacetoacetanilide; |
| CAS: | 92-15-9 |
| EINECS: | 202-131-0 |
| Molecular Formula: | C11H13NO3 |
| Molecular Weight: | 207.23 |
| InChI: | InChI=1/C11H13NO3/c1-8(13)7-11(14)12-9-5-3-4-6-10(9)15-2/h3-6H,7H2,1-2H3,(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50 |
| Flash Point: | 157 C |
| Boiling Point: | 386 |
| Density: | 1.31 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.552 |
| Water Solubility: | 3 g/L in water |
| Solubility: | 3 g/L in water |
| Appearance: | White to Off-White Powder |
| Flash Point: | 157 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Acetoacet-o-anisidide is used a intermediate for the manufacture of organic pigments. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
