| Identification | ||
| Name: | Benzenamine,4-(6-methyl-2-benzothiazolyl)- | |
| Synonyms: | Benzothiazole,1-(p-aminophenyl)-5-methyl- (3CI); Benzothiazole, 2-(p-aminophenyl)-6-methyl-(6CI,7CI,8CI); 2-(4-Aminophenyl)-6-methylbenzothiazole;2-(p-Aminophenyl)-6-methylbenzothiazole; 4-(6-Methyl-2-benzothiazolyl)aniline;4-(6-Methylbenzo[d]thiazol-2-yl)aniline; Dehydrothio-p-toluidine; NSC 15370;NSC 57678 | |
| CAS: | 92-36-4 | |
| EINECS: | 202-150-4 | |
| Molecular Formula: | C14H12 N2 S | |
| Molecular Weight: | 240.34 | |
| InChI: | InChI=1/C14H12N2S/c1-9-2-7-12-13(8-9)17-14(16-12)10-3-5-11(15)6-4-10/h2-8H,15H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Melting Point: | 191-196 ºC | |
| Boiling Point: | 434 ºC | |
| Density: | 1.264 g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.709 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | <0.1 g/100 mL at 20 ºC | |
| Appearance: | Light tan or light orange powder. Solutions have a violet-blue fluorescence. | |
| Specification: |
Fire Hazard of P-(6-methylbenzothiazole-2-YL)aniline ( 92-36-4): Flash point data for 4-(6-Methyl-2-benzothiazolyl)benzeneamine are not available; however, 4-(6-Methyl-2-benzothiazolyl)benzeneamine is probably combustible. | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
| Hazard Symbols |
Xi: Irritant
|
|
 |
||
