| Identification | |
| Name: | 4,4'-Dibromobiphenyl |
| CAS: | 92-86-4 |
| EINECS: | 202-198-6 |
| Molecular Formula: | C12H8Br2 |
| Molecular Weight: | 312 |
| InChI: | InChI=1/C12H8Br2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3152 |
| Density: | 1.667 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.625 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | White powder |
| Specification: |
? 4,4'-Dibromobiphenyl , with CAS number of 92-86-4, can be called 1,1'-biphenyl, 4,4'-dibromo- ; 4,4'-Dibromo-1,1'-biphenyl ; p,p'-Dibromobiphenyl . It is a?white powder.?4,4'-Dibromobiphenyl (CAS NO.92-86-4) is used as electronic chemicals. |
| Packinggroup: | II |
| HS Code: | 29036990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
