| Identification | |
| Name: | p-Terphenyl |
| Synonyms: | 1,4-Diphenylbenzene; 1,1':4',1''-Terphenyl; 4-Phenylbiphenyl |
| CAS: | 92-94-4 |
| EINECS: | 202-205-2 |
| Molecular Formula: | C18H14 |
| Molecular Weight: | 230.31 |
| InChI: | InChI=1/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.23 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | White solid |
| Specification: |
?p-Terphenyl , its cas register number is 92-94-4. It also can be called 1,4-Diphenylbenzene ; 1,4-Diphenylbenzene ; 4-Phenylbiphenyl ; and 1,1':4',1''-Terphenyl . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II; III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | COLORLESS OR LIGHT-YELLOW SOLID White or light-yellow solid. |
| Usage: | Polymerized with styrene to make a plastic phosphor, single crystals used as scintillation counters. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
