| Identification | |
| Name: | Pyrrolidine,2-(3-fluorophenyl)-, (2R)- |
| Synonyms: | (R)-2-(3-Fluorophenyl)pyrrolidine; |
| CAS: | 920274-03-9 |
| Molecular Formula: | C10H12FN |
| Molecular Weight: | 165.21 |
| InChI: | InChI=1/C10H12FN/c11-9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7,10,12H,2,5-6H2/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.078 g/cm3 |
| Refractive index: | 1.515 |
| Specification: |
The (R)-2-(3-Fluorophenyl)pyrrolidine with the CAS number 920274-03-9 is also called Pyrrolidine,2-(3-fluorophenyl)-, (2R)-. Its molecular formula is C10H12FN. The product category is pharmaceutical intermediate. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.83; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.26; (4)ACD/LogD (pH 7.4): -0.81; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 3.24 Å2; (13)Index of Refraction: 1.515; (14)Molar Refractivity: 46.23 cm3; (15)Molar Volume: 153.1 cm3; (16)Polarizability: 18.32×10-24cm3; (17)Surface Tension: 35.3 dyne/cm; (18)Enthalpy of Vaporization: 46.9 kJ/mol; (19)Vapour Pressure: 0.0595 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
