Identification |
Name: | [1,1'-Biphenyl]-3-amine,6-methoxy-, hydrochloride (1:1) |
Synonyms: | 3-Biphenylamine,6-methoxy-, hydrochloride (7CI); [1,1'-Biphenyl]-3-amine, 6-methoxy-,hydrochloride (9CI); 4-Methoxy-3-phenylaniline hydrochloride |
CAS: | 92028-21-2 |
Molecular Formula: | C13H13 N O . Cl H |
Molecular Weight: | 235.71 |
InChI: | InChI=1/C13H13NO.ClH/c1-15-13-8-7-11(14)9-12(13)10-5-3-2-4-6-10;/h2-9H,14H2,1H3;1H |
Molecular Structure: |
|
Properties |
Melting Point: | 237-240°C |
Flash Point: | 166.2°C |
Boiling Point: | 340.1°C at 760 mmHg |
Density: | g/cm3 |
Appearance: | off-white solid |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 166.2°C |
Safety Data |
|
|