| Identification | |
| Name: | D-Cysteine |
| Synonyms: | Cysteine,D- (8CI);(S)-Cysteine;(S)-2-Amino-3-mercaptopropionic acid; |
| CAS: | 921-01-7 |
| EINECS: | 213-062-0 |
| Molecular Formula: | C3H7NO2S |
| Molecular Weight: | 121.15 |
| InChI: | InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.334 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.549 |
| Appearance: | White crystals or crystalline powder |
| Specification: | White crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29309013 |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
