| Identification | |
| Name: | 3,3-Difluorocyclohexanamine |
| Synonyms: | cyclohexanamine, 3,3-difluoro-;LogP |
| CAS: | 921753-34-6 |
| Molecular Formula: | C6H11F2N |
| Molecular Weight: | 135.16 |
| InChI: | InChI=1/C6H11F2N/c7-6(8)3-1-2-5(9)4-6/h5H,1-4,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.086 g/cm3 |
| Refractive index: | 1.422 |
| Specification: |
The 3,3-Difluorocyclohexanamine with the cas number 921753-34-6, is also called cyclohexanamine, 3,3-difluoro- .The properties of the chemical are: (1)#H bond acceptors: 1 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 26.02 Å2 ; (5)Index of Refraction: 1.422 ; (6)Molar Refractivity: 31.626 cm3 ; (7)Molar Volume: 124.491 cm3 ; (8)Polarizability: 12.538×10-24cm3 ; (9)Surface Tension: 26.69 dyne/cm; (10)Enthalpy of Vaporization: 37.838 kJ/mol ; (11)Vapour Pressure: 5.924 mmHg at 25°C . You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
