| Identification | |
| Name: | 2-Propenoic acid,2-(chloromethyl)-, methyl ester |
| Synonyms: | Acrylicacid, 2-(chloromethyl)-, methyl ester (7CI,8CI);Methyl a-(chloromethyl)acrylate; |
| CAS: | 922-15-6 |
| Molecular Formula: | C5H7ClO2 |
| Molecular Weight: | 134.56 |
| InChI: | InChI=1/C5H7ClO2/c1-4(3-6)5(7)8-2/h1,3H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.113 |
| Refractive index: | 1.433 |
| Specification: |
The Methyl 2-(chloromethyl)acrylate with the cas number 922-15-6 is also called 2-Propenoic acid,2-(chloromethyl)-, methyl ester. The systematic name is methyl 2-(chloromethyl)prop-2-enoate. Its molecular formula is C5H7ClO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.23; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 26.3 Å2; (7)Index of Refraction: 1.433; (8)Molar Refractivity: 31.405 cm3; (9)Molar Volume: 120.831 cm3; (10)Polarizability: 12.45×10-24cm3; (11)Surface Tension: 28.604 dyne/cm; (12)Enthalpy of Vaporization: 39.336 kJ/mol; (13)Vapour Pressure: 2.859 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
