Identification |
Name: | 2-Pentene, 3-methyl-,(2Z)- |
Synonyms: | 2-Pentene,3-methyl-, (Z)- (8CI); (Z)-3-Methyl-2-pentene; cis-3-Methyl-2-pentene |
CAS: | 922-62-3 |
EINECS: | 213-078-8 |
Molecular Formula: | C6H12 |
Molecular Weight: | 84.16 |
InChI: | InChI=1S/C6H12/c1-4-6(3)5-2/h4H,5H2,1-3H3/b6-4- |
Molecular Structure: |
 |
Properties |
Transport: | UN 3295 3/PG 2 |
Flash Point: | °C |
Boiling Point: | 64.6°Cat760mmHg |
Density: | 0.695g/cm3 |
Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
Refractive index: | n20/D 1.402 |
Water Solubility: | Stability Stable. Highly flammable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. Toxicity data (The meaning of any toxicological |
Solubility: | |
Appearance: | colourless liquid |
Packinggroup: | II |
Flash Point: | °C |
Safety Data |
|
 |