| Identification | |
| Name: | 1,4-Pentadien-3-ol |
| Synonyms: | 3-Hydroxy-1,4-pentadiene;Diethenylmethyl alcohol;Divinylcarbinol; |
| CAS: | 922-65-6 |
| EINECS: | 213-080-9 |
| Molecular Formula: | C5H8O |
| Molecular Weight: | 84.12 |
| InChI: | InChI=1/C5H8O/c1-3-5(6)4-2/h3-6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Flash Point: | 86? |
| Density: | 0.865 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.445 |
| Appearance: | Colorless clear liquid |
| Specification: |
1,4-Pentadien-3-ol , with CAS number of 922-65-6, can be called 3-Hydroxy-1,4-pentadiene ; Diethenylmethyl alcohol ; Divinylcarbinol . |
| Packinggroup: | III |
| Flash Point: | 86? |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
