| Identification | |
| Name: | DL-Cystine |
| Synonyms: | Cystine,DL- (8CI); DL-Cystine; NSC 203781 |
| CAS: | 923-32-0 |
| EINECS: | 213-094-5 |
| Molecular Formula: | C6H12N2O4S2 |
| Molecular Weight: | 240.29 |
| InChI: | InChI=1/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.571 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.652 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystalline powder |
| Specification: | white to off-white powder Safety Statements:37/39-26-24/25-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29309014 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
