| Identification | |
| Name: | 4-Chloroisoindoline hydrochloride |
| Synonyms: | 1H-isoindole, 4-chloro-2,3-dihydro-, hydrochloride (1:1);4-Chloroisoindoline hydrochloride (1:1);4-Chloroisoindoline HCl; |
| CAS: | 924304-73-4 |
| Molecular Formula: | C8H8ClN.HCl |
| Molecular Weight: | 190.07 |
| InChI: | InChI=1/C8H8ClN.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5H2;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 4-Chloroisoindoline hydrochloride with the cas number 924304-73-4, is also called 1H-isoindole, 4-chloro-2,3-dihydro-, hydrochloride (1:1) .This product can be supplied by the following suppliers: (1)Shanghai Qingsong Pharmaceutical Co., Ltd.; (2)Suzhou Rovathin Foreign Trade Co., Ltd.. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
