| Identification | |
| Name: | Butanedioic acid,1,4-bis(2-methylpropyl) ester |
| Synonyms: | Butanedioicacid, bis(2-methylpropyl) ester (9CI);Succinic acid, diisobutyl ester(7CI,8CI);Diisobutyl succinate; |
| CAS: | 925-06-4 |
| EINECS: | 213-113-7 |
| Molecular Formula: | C12H22O4 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C12H22O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h9-10H,5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.982 g/cm3 |
| Refractive index: | 1.434 |
| Specification: |
The Diisobutyl succinate, with the CAS registry number 925-06-4, is also known as Butanedioic acid, 1,4-bis(2-methylpropyl) ester. Its EINECS registry number is 213-113-7. This chemical's molecular formula is C12H22O4 and molecular weight is 230.3. Its IUPAC name and systematic name are the same which is called bis(2-methylpropyl) butanedioate. Physical properties of Diisobutyl succinate: (1)ACD/LogP: 3.02; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.02; (4)ACD/LogD (pH 7.4): 3.02; (5)ACD/BCF (pH 5.5): 115.81; (6)ACD/BCF (pH 7.4): 115.81; (7)ACD/KOC (pH 5.5): 1044.35; (8)ACD/KOC (pH 7.4): 1044.35; (9)#H bond acceptors: 4; (10)#Freely Rotating Bonds: 9; (11)Index of Refraction: 1.434; (12)Molar Refractivity: 61.11 cm3; (13)Molar Volume: 234.3 cm3; (14)Surface Tension: 31.1 dyne/cm; (15)Density: 0.982 g/cm3; (16)Flash Point: 109.8 °C; (17)Enthalpy of Vaporization: 49 kJ/mol; (18)Boiling Point: 252.6 °C at 760 mmHg; (19)Vapour Pressure: 0.0192 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
