| Identification |
| Name: | 1-Propanamine,N,N-dimethyl- |
| Synonyms: | Propylamine,N,N-dimethyl- (6CI,7CI,8CI); Dimethylammonium propane; Dimethylpropylamine;N,N-Dimethyl-n-propylamine; N,N-Dimethylpropanamine; N,N-Dimethylpropylamine;Propyldimethylamine |
| CAS: | 926-63-6 |
| EINECS: | 213-139-9 |
| Molecular Formula: | C5H13 N |
| Molecular Weight: | 87.16 |
| InChI: | InChI=1/C5H13N/c1-4-5-6(2)3/h4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2266 |
| Melting Point: | -95 |
| Flash Point: | °C |
| Boiling Point: | 67.3°Cat760mmHg |
| Density: | 0.736g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.3860 (20 C) |
| Solubility: | Very soluble |
| Appearance: | A colorless liquid. |
| Packinggroup: | II |
| Flash Point: | °C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used to make other chemicals. |
| Safety Data |
| |
 |
