| Identification |
| Name: | 1,4-Butanediol, terephthalic acid, adipic acid polyester resin |
| Synonyms: | AC1O58PA;Terephthalic acid, adipic acid, 1,4-butanediol polymer;butane-1,4-diol; hexanedioic acid; terephthalic acid;1,4-Butylene glycol, adipic acid, terephthalic acid polymer;1,4-Butanediol, terephthalic acid, adipic acid polyester resin;1,4-Benzenedicarboxylic acid, polymer with 1,4-butanediol and hexanedioic acid;141490-13-3;191234-31-8;221695-34-7;384836-52-6;409093-81-8;460717-18-4;467221-15-4;470453-41-9;60961-73-1;92680-63-2 |
| CAS: | 92680-63-2 |
| Molecular Formula: | C18H26O10 |
| Molecular Weight: | 402.39304 |
| InChI: | InChI=1S/C8H6O4.C6H10O4.C4H10O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-5(8)3-1-2-4-6(9)10;5-3-1-2-4-6/h1-4H,(H,9,10)(H,11,12);1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 205.3°C |
| Boiling Point: | 392.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 205.3°C |
| Safety Data |
| |
 |
