| Identification |
| Name: | N,N-Dimethylbutylamine |
| Synonyms: | 1-Butanamine,N,N-dimethyl-; ar84996; Butylamine, N,N-dimethyl-; Butyldimethylamine; butyl-dimethyl-amine; n,n-dimethyl-1-butanamin; N,N-Dimethyl-1-butanamine; n,n-dimethyl-butylamin |
| CAS: | 927-62-8 |
| EINECS: | 213-156-1 |
| Molecular Formula: | C6H15N |
| Molecular Weight: | 101.19 |
| InChI: | InChI=1/C6H15N/c1-4-5-6-7(2)3/h4-6H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2733 |
| Density: | 0.72 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. Highly flammable - note low flashpoint. |
| Refractive index: | 1.397-1.399 |
| Solubility: | 3.4 g/100 mL (20 ºC) in water |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Flammables-area. |
| Safety Data |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
| |
 |
